C24H34O6Si2 — CID 11826857
dimethyl 2,3-diphenyl-2,3-bis(trimethylsilyloxy)butanedioate (PubChem CID 11826857) has the molecular formula C24H34O6Si2 and a molecular weight of 474.70 g/mol. Its IUPAC name is dimethyl 2,3-diphenyl-2,3-bis(trimethylsilyloxy)butanedioate.
| Compound Name | dimethyl 2,3-diphenyl-2,3-bis(trimethylsilyloxy)butanedioate |
|---|---|
| PubChem CID | 11826857 |
| Molecular Formula | C24H34O6Si2 |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | dimethyl 2,3-diphenyl-2,3-bis(trimethylsilyloxy)butanedioate |
| SMILES | COC(=O)C(O[Si](C)(C)C)(c1ccccc1)C(O[Si](C)(C)C)(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C24H34O6Si2/c1-27-21(25)23(29-31(3,4)5,19-15-11-9-12-16-19)24(22(26)28-2,30-32(6,7)8)20-17-13-10-14-18-20/h9-18H,1-8H3 |
| InChIKey | CSRWTWDGJQWRFG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.70 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|