C18H20N2O4 — CID 20696173
methyl 2-[2-(2-methoxyacetyl)hydrazinyl]-2,2-diphenylacetate (PubChem CID 20696173) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is methyl 2-[2-(2-methoxyacetyl)hydrazinyl]-2,2-diphenylacetate.
| Compound Name | methyl 2-[2-(2-methoxyacetyl)hydrazinyl]-2,2-diphenylacetate |
|---|---|
| PubChem CID | 20696173 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | methyl 2-[2-(2-methoxyacetyl)hydrazinyl]-2,2-diphenylacetate |
| SMILES | COCC(=O)NNC(C(=O)OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O4/c1-23-13-16(21)19-20-18(17(22)24-2,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,20H,13H2,1-2H3,(H,19,21) |
| InChIKey | MBPBOZGXYCKGIL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|