C21H20N2O2 — CID 162399408
methyl 2,2-diphenyl-2-(pyridin-2-ylmethylamino)acetate (PubChem CID 162399408) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 2,2-diphenyl-2-(pyridin-2-ylmethylamino)acetate.
| Compound Name | methyl 2,2-diphenyl-2-(pyridin-2-ylmethylamino)acetate |
|---|---|
| PubChem CID | 162399408 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | methyl 2,2-diphenyl-2-(pyridin-2-ylmethylamino)acetate |
| SMILES | COC(=O)C(NCc1ccccn1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O2/c1-25-20(24)21(17-10-4-2-5-11-17,18-12-6-3-7-13-18)23-16-19-14-8-9-15-22-19/h2-15,23H,16H2,1H3 |
| InChIKey | ZTTFIKFCKYRELR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |