C32H39N3O2 — CID 175104669
(dicyclohexylamino) 2,2-diphenyl-2-(pyridin-2-ylmethylamino)acetate (PubChem CID 175104669) has the molecular formula C32H39N3O2 and a molecular weight of 497.68 g/mol. Its IUPAC name is (dicyclohexylamino) 2,2-diphenyl-2-(pyridin-2-ylmethylamino)acetate.
| Compound Name | (dicyclohexylamino) 2,2-diphenyl-2-(pyridin-2-ylmethylamino)acetate |
|---|---|
| PubChem CID | 175104669 |
| Molecular Formula | C32H39N3O2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | (dicyclohexylamino) 2,2-diphenyl-2-(pyridin-2-ylmethylamino)acetate |
| SMILES | O=C(ON(C1CCCCC1)C1CCCCC1)C(NCc1ccccn1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H39N3O2/c36-31(37-35(29-20-9-3-10-21-29)30-22-11-4-12-23-30)32(26-15-5-1-6-16-26,27-17-7-2-8-18-27)34-25-28-19-13-14-24-33-28/h1-2,5-8,13-19,24,29-30,34H,3-4,9-12,20-23,25H2 |
| InChIKey | YRSCOZYVGQWOSP-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|