C12H14N2O2 — CID 10846468
methyl (2E,4E)-5-(pyridin-2-ylmethylamino)penta-2,4-dienoate (PubChem CID 10846468) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is methyl (2E,4E)-5-(pyridin-2-ylmethylamino)penta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-5-(pyridin-2-ylmethylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 10846468 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | methyl (2E,4E)-5-(pyridin-2-ylmethylamino)penta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/NCc1ccccn1 |
| InChI | InChI=1S/C12H14N2O2/c1-16-12(15)7-3-4-8-13-10-11-6-2-5-9-14-11/h2-9,13H,10H2,1H3/b7-3+,8-4+ |
| InChIKey | GLVMCXWMOJBKFG-FCXRPNKRSA-N |
| XLogP | 1.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|