C20H21N5 — CID 66810165
N,N',N'-tris(pyridin-2-ylmethyl)ethene-1,2-diamine (PubChem CID 66810165) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is N,N',N'-tris(pyridin-2-ylmethyl)ethene-1,2-diamine.
| Compound Name | N,N',N'-tris(pyridin-2-ylmethyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 66810165 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N,N',N'-tris(pyridin-2-ylmethyl)ethene-1,2-diamine |
| SMILES | C(=CN(Cc1ccccn1)Cc1ccccn1)NCc1ccccn1 |
| InChI | InChI=1S/C20H21N5/c1-4-10-22-18(7-1)15-21-13-14-25(16-19-8-2-5-11-23-19)17-20-9-3-6-12-24-20/h1-14,21H,15-17H2 |
| InChIKey | VBYSHJOGGQDYQJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |