C12H12BN3 — CID 88902013
CID 88902013 (PubChem CID 88902013) has the molecular formula C12H12BN3 and a molecular weight of 209.06 g/mol.
| Compound Name | CID 88902013 |
|---|---|
| PubChem CID | 88902013 |
| Molecular Formula | C12H12BN3 |
| Molecular Weight | 209.06 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | — |
| SMILES | [B]N(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C12H12BN3/c13-16(9-11-5-1-3-7-14-11)10-12-6-2-4-8-15-12/h1-8H,9-10H2 |
| InChIKey | LDXPZGYMCMTZCN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.06 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|