C24H24N4O2 — CID 21236262
N,N'-bis(2-methylphenyl)-2-[(pyridin-2-ylmethylamino)methylidene]propanediamide (PubChem CID 21236262) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N,N'-bis(2-methylphenyl)-2-[(pyridin-2-ylmethylamino)methylidene]propanediamide.
| Compound Name | N,N'-bis(2-methylphenyl)-2-[(pyridin-2-ylmethylamino)methylidene]propanediamide |
|---|---|
| PubChem CID | 21236262 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N,N'-bis(2-methylphenyl)-2-[(pyridin-2-ylmethylamino)methylidene]propanediamide |
| SMILES | Cc1ccccc1NC(=O)C(=CNCc1ccccn1)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C24H24N4O2/c1-17-9-3-5-12-21(17)27-23(29)20(16-25-15-19-11-7-8-14-26-19)24(30)28-22-13-6-4-10-18(22)2/h3-14,16,25H,15H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | KZYXRZGXFIZPRF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|