C17H17N3O4 — CID 108501782
ethyl 2-[[2-oxo-2-(pyridin-2-ylmethylamino)acetyl]amino]benzoate (PubChem CID 108501782) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is ethyl 2-[[2-oxo-2-(pyridin-2-ylmethylamino)acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-oxo-2-(pyridin-2-ylmethylamino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 108501782 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | ethyl 2-[[2-oxo-2-(pyridin-2-ylmethylamino)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C17H17N3O4/c1-2-24-17(23)13-8-3-4-9-14(13)20-16(22)15(21)19-11-12-7-5-6-10-18-12/h3-10H,2,11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | ZCWPPNAHCZWFNA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|