C17H22O3Si — CID 175023503
1,1-diphenylethyl(trimethoxy)silane (PubChem CID 175023503) has the molecular formula C17H22O3Si and a molecular weight of 302.45 g/mol. Its IUPAC name is 1,1-diphenylethyl(trimethoxy)silane.
| Compound Name | 1,1-diphenylethyl(trimethoxy)silane |
|---|---|
| PubChem CID | 175023503 |
| Molecular Formula | C17H22O3Si |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1,1-diphenylethyl(trimethoxy)silane |
| SMILES | CO[Si](OC)(OC)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H22O3Si/c1-17(15-11-7-5-8-12-15,16-13-9-6-10-14-16)21(18-2,19-3)20-4/h5-14H,1-4H3 |
| InChIKey | STUYATWONBDSQO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|