C38H35NSi2 — CID 174310291
1,1-bis(triphenylsilyl)ethanamine (PubChem CID 174310291) has the molecular formula C38H35NSi2 and a molecular weight of 561.88 g/mol. Its IUPAC name is 1,1-bis(triphenylsilyl)ethanamine.
| Compound Name | 1,1-bis(triphenylsilyl)ethanamine |
|---|---|
| PubChem CID | 174310291 |
| Molecular Formula | C38H35NSi2 |
| Molecular Weight | 561.88 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | 1,1-bis(triphenylsilyl)ethanamine |
| SMILES | CC(N)([Si](c1ccccc1)(c1ccccc1)c1ccccc1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H35NSi2/c1-38(39,40(32-20-8-2-9-21-32,33-22-10-3-11-23-33)34-24-12-4-13-25-34)41(35-26-14-5-15-27-35,36-28-16-6-17-29-36)37-30-18-7-19-31-37/h2-31H,39H2,1H3 |
| InChIKey | KQGAHIDFYNPAPJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|