C28H29NSi — CID 4663301
N,N-dimethyl-1-phenyl-1-triphenylsilylethanamine (PubChem CID 4663301) has the molecular formula C28H29NSi and a molecular weight of 407.63 g/mol. Its IUPAC name is N,N-dimethyl-1-phenyl-1-triphenylsilylethanamine.
| Compound Name | N,N-dimethyl-1-phenyl-1-triphenylsilylethanamine |
|---|---|
| PubChem CID | 4663301 |
| Molecular Formula | C28H29NSi |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N,N-dimethyl-1-phenyl-1-triphenylsilylethanamine |
| SMILES | CN(C)C(C)(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H29NSi/c1-28(29(2)3,24-16-8-4-9-17-24)30(25-18-10-5-11-19-25,26-20-12-6-13-21-26)27-22-14-7-15-23-27/h4-23H,1-3H3 |
| InChIKey | QXFKWHWVNRJKIO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|