C20H23NOSi — CID 11716759
tert-butyl-(3-methyl-1,2-oxazol-5-yl)-diphenylsilane (PubChem CID 11716759) has the molecular formula C20H23NOSi and a molecular weight of 321.50 g/mol. Its IUPAC name is tert-butyl-(3-methyl-1,2-oxazol-5-yl)-diphenylsilane.
| Compound Name | tert-butyl-(3-methyl-1,2-oxazol-5-yl)-diphenylsilane |
|---|---|
| PubChem CID | 11716759 |
| Molecular Formula | C20H23NOSi |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | tert-butyl-(3-methyl-1,2-oxazol-5-yl)-diphenylsilane |
| SMILES | Cc1cc([Si](c2ccccc2)(c2ccccc2)C(C)(C)C)on1 |
| InChI | InChI=1S/C20H23NOSi/c1-16-15-19(22-21-16)23(20(2,3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-15H,1-4H3 |
| InChIKey | ACQSDFTZAAWRTG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|