C18H17NO2 — CID 852788
2-(3-methyl-1,2-oxazol-5-yl)-1,1-diphenylethanol (PubChem CID 852788) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(3-methyl-1,2-oxazol-5-yl)-1,1-diphenylethanol.
| Compound Name | 2-(3-methyl-1,2-oxazol-5-yl)-1,1-diphenylethanol |
|---|---|
| PubChem CID | 852788 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-(3-methyl-1,2-oxazol-5-yl)-1,1-diphenylethanol |
| SMILES | Cc1cc(CC(O)(c2ccccc2)c2ccccc2)on1 |
| InChI | InChI=1S/C18H17NO2/c1-14-12-17(21-19-14)13-18(20,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-12,20H,13H2,1H3 |
| InChIKey | UOQBMXMKCDGTOM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |