C13H16N2O — CID 60713961
N-[(3-methyl-1,2-oxazol-5-yl)methyl]-1-phenylethanamine (PubChem CID 60713961) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-[(3-methyl-1,2-oxazol-5-yl)methyl]-1-phenylethanamine.
| Compound Name | N-[(3-methyl-1,2-oxazol-5-yl)methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 60713961 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-[(3-methyl-1,2-oxazol-5-yl)methyl]-1-phenylethanamine |
| SMILES | Cc1cc(CNC(C)c2ccccc2)on1 |
| InChI | InChI=1S/C13H16N2O/c1-10-8-13(16-15-10)9-14-11(2)12-6-4-3-5-7-12/h3-8,11,14H,9H2,1-2H3 |
| InChIKey | OPUPMAMKZGRKLQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |