C20H19NO2 — CID 852777
(E,2S)-1-(3-methyl-1,2-oxazol-5-yl)-2,4-diphenylbut-3-en-2-ol (PubChem CID 852777) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (E,2S)-1-(3-methyl-1,2-oxazol-5-yl)-2,4-diphenylbut-3-en-2-ol.
| Compound Name | (E,2S)-1-(3-methyl-1,2-oxazol-5-yl)-2,4-diphenylbut-3-en-2-ol |
|---|---|
| PubChem CID | 852777 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (E,2S)-1-(3-methyl-1,2-oxazol-5-yl)-2,4-diphenylbut-3-en-2-ol |
| SMILES | Cc1cc(C[C@](O)(/C=C/c2ccccc2)c2ccccc2)on1 |
| InChI | InChI=1S/C20H19NO2/c1-16-14-19(23-21-16)15-20(22,18-10-6-3-7-11-18)13-12-17-8-4-2-5-9-17/h2-14,22H,15H2,1H3/b13-12+/t20-/m1/s1 |
| InChIKey | RRIDKSXWEQOLJO-DRUFCSCSSA-N |
| XLogP | 4.13 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |