C21H23NO2 — CID 102156142
(E)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2,4-diphenylbut-3-en-2-ol (PubChem CID 102156142) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (E)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2,4-diphenylbut-3-en-2-ol.
| Compound Name | (E)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2,4-diphenylbut-3-en-2-ol |
|---|---|
| PubChem CID | 102156142 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (E)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2,4-diphenylbut-3-en-2-ol |
| SMILES | CC1(C)COC(CC(O)(/C=C/c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C21H23NO2/c1-20(2)16-24-19(22-20)15-21(23,18-11-7-4-8-12-18)14-13-17-9-5-3-6-10-17/h3-14,23H,15-16H2,1-2H3/b14-13+ |
| InChIKey | JZIAJEWNNBAGFZ-BUHFOSPRSA-N |
| XLogP | 4.18 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |