C22H22O — CID 100942786
(1E,4E)-3-(1-ethenylcyclopropyl)-1,5-diphenylpenta-1,4-dien-3-ol (PubChem CID 100942786) has the molecular formula C22H22O and a molecular weight of 302.42 g/mol. Its IUPAC name is (1E,4E)-3-(1-ethenylcyclopropyl)-1,5-diphenylpenta-1,4-dien-3-ol.
| Compound Name | (1E,4E)-3-(1-ethenylcyclopropyl)-1,5-diphenylpenta-1,4-dien-3-ol |
|---|---|
| PubChem CID | 100942786 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (1E,4E)-3-(1-ethenylcyclopropyl)-1,5-diphenylpenta-1,4-dien-3-ol |
| SMILES | C=CC1(C(O)(/C=C/c2ccccc2)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C22H22O/c1-2-21(17-18-21)22(23,15-13-19-9-5-3-6-10-19)16-14-20-11-7-4-8-12-20/h2-16,23H,1,17-18H2/b15-13+,16-14+ |
| InChIKey | LGPAKTQRYOFQSF-WXUKJITCSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|