About 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol
1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol (PubChem CID 102581061) has the molecular formula C21H24O2
and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol |
| PubChem CID | 102581061 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol |
| SMILES | OC1(C(O)(/C=C/c2ccccc2)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C21H24O2/c22-20(15-8-3-9-16-20)21(23,19-12-6-2-7-13-19)17-14-18-10-4-1-5-11-18/h1-2,4-7,10-14,17,22-23H,3,8-9,15-16H2/b17-14+ |
| InChIKey | DBKUGULJKIFXRN-SAPNQHFASA-N |
| XLogP | 4.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol?
The IUPAC name of 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol (CID 102581061) is 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol?
The canonical SMILES for 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol is OC1(C(O)(/C=C/c2ccccc2)c2ccccc2)CCCCC1.
What is the InChIKey of 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol?
The InChIKey is DBKUGULJKIFXRN-SAPNQHFASA-N. The full InChI is InChI=1S/C21H24O2/c22-20(15-8-3-9-16-20)21(23,19-12-6-2-7-13-19)17-14-18-10-4-1-5-11-18/h1-2,4-7,10-14,17,22-23H,3,8-9,15-16H2/b17-14+.
What are the key properties of 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol?
1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol has a molecular weight of 308.42 g/mol, XLogP of 4.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-1-hydroxy-1,3-diphenylprop-2-enyl]cyclohexan-1-ol is sourced from PubChem (CID 102581061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).