C15H20OS — CID 134932973
1-[(Z)-1-methylsulfanyl-2-phenylethenyl]cyclohexan-1-ol (PubChem CID 134932973) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-[(Z)-1-methylsulfanyl-2-phenylethenyl]cyclohexan-1-ol.
| Compound Name | 1-[(Z)-1-methylsulfanyl-2-phenylethenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 134932973 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-[(Z)-1-methylsulfanyl-2-phenylethenyl]cyclohexan-1-ol |
| SMILES | CS/C(=C\c1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C15H20OS/c1-17-14(12-13-8-4-2-5-9-13)15(16)10-6-3-7-11-15/h2,4-5,8-9,12,16H,3,6-7,10-11H2,1H3/b14-12- |
| InChIKey | FBHKAVSOTIOWFS-OWBHPGMISA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |