About 1-hydroxycyclohexane-1-carbaldehyde;styrene
1-hydroxycyclohexane-1-carbaldehyde;styrene (PubChem CID 174375835) has the molecular formula C15H20O2
and a molecular weight of 232.32 g/mol. Its IUPAC name is 1-hydroxycyclohexane-1-carbaldehyde;styrene.
Molecular Properties
| Compound Name | 1-hydroxycyclohexane-1-carbaldehyde;styrene |
| PubChem CID | 174375835 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 1-hydroxycyclohexane-1-carbaldehyde;styrene |
| SMILES | C=Cc1ccccc1.O=CC1(O)CCCCC1 |
| InChI | InChI=1S/C8H8.C7H12O2/c1-2-8-6-4-3-5-7-8;8-6-7(9)4-2-1-3-5-7/h2-7H,1H2;6,9H,1-5H2 |
| InChIKey | CCQAOZXHUWXBEG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxycyclohexane-1-carbaldehyde;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxycyclohexane-1-carbaldehyde;styrene?
The IUPAC name of 1-hydroxycyclohexane-1-carbaldehyde;styrene (CID 174375835) is 1-hydroxycyclohexane-1-carbaldehyde;styrene.
What is the SMILES notation for 1-hydroxycyclohexane-1-carbaldehyde;styrene?
The canonical SMILES for 1-hydroxycyclohexane-1-carbaldehyde;styrene is C=Cc1ccccc1.O=CC1(O)CCCCC1.
What is the InChIKey of 1-hydroxycyclohexane-1-carbaldehyde;styrene?
The InChIKey is CCQAOZXHUWXBEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C7H12O2/c1-2-8-6-4-3-5-7-8;8-6-7(9)4-2-1-3-5-7/h2-7H,1H2;6,9H,1-5H2.
What are the key properties of 1-hydroxycyclohexane-1-carbaldehyde;styrene?
1-hydroxycyclohexane-1-carbaldehyde;styrene has a molecular weight of 232.32 g/mol, XLogP of 3.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxycyclohexane-1-carbaldehyde;styrene is sourced from PubChem (CID 174375835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).