C22H24O — CID 23267885
1-(4,4-diphenylbuta-2,3-dien-2-yl)cyclohexan-1-ol (PubChem CID 23267885) has the molecular formula C22H24O and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-(4,4-diphenylbuta-2,3-dien-2-yl)cyclohexan-1-ol.
| Compound Name | 1-(4,4-diphenylbuta-2,3-dien-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 23267885 |
| Molecular Formula | C22H24O |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-(4,4-diphenylbuta-2,3-dien-2-yl)cyclohexan-1-ol |
| SMILES | CC(=C=C(c1ccccc1)c1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C22H24O/c1-18(22(23)15-9-4-10-16-22)17-21(19-11-5-2-6-12-19)20-13-7-3-8-14-20/h2-3,5-8,11-14,23H,4,9-10,15-16H2,1H3 |
| InChIKey | ZDRLTHSQRDQQLR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |