C19H20 — CID 134977921
(3-ethyl-1-phenylpenta-1,2-dienyl)benzene (PubChem CID 134977921) has the molecular formula C19H20 and a molecular weight of 248.37 g/mol. Its IUPAC name is (3-ethyl-1-phenylpenta-1,2-dienyl)benzene.
| Compound Name | (3-ethyl-1-phenylpenta-1,2-dienyl)benzene |
|---|---|
| PubChem CID | 134977921 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (3-ethyl-1-phenylpenta-1,2-dienyl)benzene |
| SMILES | CCC(=C=C(c1ccccc1)c1ccccc1)CC |
| InChI | InChI=1S/C19H20/c1-3-16(4-2)15-19(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,3-4H2,1-2H3 |
| InChIKey | BKUKCIPJVLNANW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |