C22H17NO — CID 134922971
2,4,4-triphenylbuta-2,3-dienamide (PubChem CID 134922971) has the molecular formula C22H17NO and a molecular weight of 311.38 g/mol. Its IUPAC name is 2,4,4-triphenylbuta-2,3-dienamide.
| Compound Name | 2,4,4-triphenylbuta-2,3-dienamide |
|---|---|
| PubChem CID | 134922971 |
| Molecular Formula | C22H17NO |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2,4,4-triphenylbuta-2,3-dienamide |
| SMILES | NC(=O)C(=C=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17NO/c23-22(24)21(19-14-8-3-9-15-19)16-20(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-15H,(H2,23,24) |
| InChIKey | KFESAIVMXFRXMA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|