C16H21N3O2 — CID 5338692
[(E)-[(E)-1-(1-hydroxycyclohexyl)-3-phenylprop-2-enylidene]amino]urea (PubChem CID 5338692) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is [(E)-[(E)-1-(1-hydroxycyclohexyl)-3-phenylprop-2-enylidene]amino]urea.
| Compound Name | [(E)-[(E)-1-(1-hydroxycyclohexyl)-3-phenylprop-2-enylidene]amino]urea |
|---|---|
| PubChem CID | 5338692 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | [(E)-[(E)-1-(1-hydroxycyclohexyl)-3-phenylprop-2-enylidene]amino]urea |
| SMILES | NC(=O)N/N=C(\C=C\c1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C16H21N3O2/c17-15(20)19-18-14(16(21)11-5-2-6-12-16)10-9-13-7-3-1-4-8-13/h1,3-4,7-10,21H,2,5-6,11-12H2,(H3,17,19,20)/b10-9+,18-14+ |
| InChIKey | XWZQRYLKHUIANS-BFHPBESDSA-N |
| XLogP | 2.42 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|