C11H13N3O2 — CID 136716120
[(Z)-[(E)-4-(4-hydroxyphenyl)but-3-en-2-ylidene]amino]urea (PubChem CID 136716120) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is [(Z)-[(E)-4-(4-hydroxyphenyl)but-3-en-2-ylidene]amino]urea.
| Compound Name | [(Z)-[(E)-4-(4-hydroxyphenyl)but-3-en-2-ylidene]amino]urea |
|---|---|
| PubChem CID | 136716120 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | [(Z)-[(E)-4-(4-hydroxyphenyl)but-3-en-2-ylidene]amino]urea |
| SMILES | CC(/C=C/c1ccc(O)cc1)=N/NC(N)=O |
| InChI | InChI=1S/C11H13N3O2/c1-8(13-14-11(12)16)2-3-9-4-6-10(15)7-5-9/h2-7,15H,1H3,(H3,12,14,16)/b3-2+,13-8- |
| InChIKey | IKDJOJMSRRXVBV-CQKMHEBXSA-N |
| XLogP | 1.45 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|