C14H11F7N2O — CID 7124439
2,2,3,3,4,4,4-heptafluoro-N-[(E)-[(E)-4-phenylbut-3-en-2-ylidene]amino]butanamide (PubChem CID 7124439) has the molecular formula C14H11F7N2O and a molecular weight of 356.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[(E)-[(E)-4-phenylbut-3-en-2-ylidene]amino]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[(E)-[(E)-4-phenylbut-3-en-2-ylidene]amino]butanamide |
|---|---|
| PubChem CID | 7124439 |
| Molecular Formula | C14H11F7N2O |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[(E)-[(E)-4-phenylbut-3-en-2-ylidene]amino]butanamide |
| SMILES | CC(/C=C/c1ccccc1)=N\NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H11F7N2O/c1-9(7-8-10-5-3-2-4-6-10)22-23-11(24)12(15,16)13(17,18)14(19,20)21/h2-8H,1H3,(H,23,24)/b8-7+,22-9+ |
| InChIKey | DCWVRJUILJBUSB-GSXCIMNCSA-N |
| XLogP | 4.02 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|