C28H36Si — CID 140882065
tert-butyl-tris(3,5-dimethylphenyl)silane (PubChem CID 140882065) has the molecular formula C28H36Si and a molecular weight of 400.68 g/mol. Its IUPAC name is tert-butyl-tris(3,5-dimethylphenyl)silane.
| Compound Name | tert-butyl-tris(3,5-dimethylphenyl)silane |
|---|---|
| PubChem CID | 140882065 |
| Molecular Formula | C28H36Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | tert-butyl-tris(3,5-dimethylphenyl)silane |
| SMILES | Cc1cc(C)cc([Si](c2cc(C)cc(C)c2)(c2cc(C)cc(C)c2)C(C)(C)C)c1 |
| InChI | InChI=1S/C28H36Si/c1-19-10-20(2)14-25(13-19)29(28(7,8)9,26-15-21(3)11-22(4)16-26)27-17-23(5)12-24(6)18-27/h10-18H,1-9H3 |
| InChIKey | CFRHHSZHUDETTF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|