C12H21N — CID 160733965
N,N-dimethylmethanamine;1,3,5-trimethylbenzene (PubChem CID 160733965) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N,N-dimethylmethanamine;1,3,5-trimethylbenzene.
| Compound Name | N,N-dimethylmethanamine;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 160733965 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N,N-dimethylmethanamine;1,3,5-trimethylbenzene |
| SMILES | CN(C)C.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C9H12.C3H9N/c1-7-4-8(2)6-9(3)5-7;1-4(2)3/h4-6H,1-3H3;1-3H3 |
| InChIKey | RUSAUBVYJITZHO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |