C8H12N+ — CID 1274251
(3,5-dimethylphenyl)azanium (PubChem CID 1274251) has the molecular formula C8H12N+ and a molecular weight of 122.19 g/mol. Its IUPAC name is (3,5-dimethylphenyl)azanium.
| Compound Name | (3,5-dimethylphenyl)azanium |
|---|---|
| PubChem CID | 1274251 |
| Molecular Formula | C8H12N+ |
| Molecular Weight | 122.19 g/mol |
| Exact Mass | 122.10 |
| IUPAC Name | (3,5-dimethylphenyl)azanium |
| SMILES | Cc1cc(C)cc([NH3+])c1 |
| InChI | InChI=1S/C8H11N/c1-6-3-7(2)5-8(9)4-6/h3-5H,9H2,1-2H3/p+1 |
| InChIKey | MKARNSWMMBGSHX-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |