C27H31IN2Si — CID 11663829
tert-butyl-(1,5-dimethyl-2-phenylpyrazol-2-ium-3-yl)-diphenylsilane iodide (PubChem CID 11663829) has the molecular formula C27H31IN2Si and a molecular weight of 538.55 g/mol. Its IUPAC name is tert-butyl-(1,5-dimethyl-2-phenylpyrazol-2-ium-3-yl)-diphenylsilane iodide.
| Compound Name | tert-butyl-(1,5-dimethyl-2-phenylpyrazol-2-ium-3-yl)-diphenylsilane iodide |
|---|---|
| PubChem CID | 11663829 |
| Molecular Formula | C27H31IN2Si |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | tert-butyl-(1,5-dimethyl-2-phenylpyrazol-2-ium-3-yl)-diphenylsilane iodide |
| SMILES | Cc1cc([Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[n+](-c2ccccc2)n1C.[I-] |
| InChI | InChI=1S/C27H31N2Si.HI/c1-22-21-26(29(28(22)5)23-15-9-6-10-16-23)30(27(2,3)4,24-17-11-7-12-18-24)25-19-13-8-14-20-25;/h6-21H,1-5H3;1H/q+1;/p-1 |
| InChIKey | SONQRUVDHPJYKI-UHFFFAOYSA-M |
| XLogP | 0.88 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|