C27H32N2Si — CID 101481600
tert-butyl-(2,3-dimethyl-1-phenyl-3H-pyrazol-5-yl)-diphenylsilane (PubChem CID 101481600) has the molecular formula C27H32N2Si and a molecular weight of 412.65 g/mol. Its IUPAC name is tert-butyl-(2,3-dimethyl-1-phenyl-3H-pyrazol-5-yl)-diphenylsilane.
| Compound Name | tert-butyl-(2,3-dimethyl-1-phenyl-3H-pyrazol-5-yl)-diphenylsilane |
|---|---|
| PubChem CID | 101481600 |
| Molecular Formula | C27H32N2Si |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | tert-butyl-(2,3-dimethyl-1-phenyl-3H-pyrazol-5-yl)-diphenylsilane |
| SMILES | CC1C=C([Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(c2ccccc2)N1C |
| InChI | InChI=1S/C27H32N2Si/c1-22-21-26(29(28(22)5)23-15-9-6-10-16-23)30(27(2,3)4,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-22H,1-5H3 |
| InChIKey | YIHKIPSQFWDZKG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|