C11H14N2Se — CID 171384384
2,5-dimethyl-1-phenyl-3H-pyrazole-3-selenol (PubChem CID 171384384) has the molecular formula C11H14N2Se and a molecular weight of 253.21 g/mol. Its IUPAC name is 2,5-dimethyl-1-phenyl-3H-pyrazole-3-selenol.
| Compound Name | 2,5-dimethyl-1-phenyl-3H-pyrazole-3-selenol |
|---|---|
| PubChem CID | 171384384 |
| Molecular Formula | C11H14N2Se |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2,5-dimethyl-1-phenyl-3H-pyrazole-3-selenol |
| SMILES | CC1=CC([SeH])N(C)N1c1ccccc1 |
| InChI | InChI=1S/C11H14N2Se/c1-9-8-11(14)12(2)13(9)10-6-4-3-5-7-10/h3-8,11,14H,1-2H3 |
| InChIKey | LJAJOQRWHARWJN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|