C16H26N2Si4 — CID 175346940
2,3,5,6-tetramethyl-1,4-diphenyl-1,4,2,3,5,6-diazatetrasilinane (PubChem CID 175346940) has the molecular formula C16H26N2Si4 and a molecular weight of 358.74 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-1,4-diphenyl-1,4,2,3,5,6-diazatetrasilinane.
| Compound Name | 2,3,5,6-tetramethyl-1,4-diphenyl-1,4,2,3,5,6-diazatetrasilinane |
|---|---|
| PubChem CID | 175346940 |
| Molecular Formula | C16H26N2Si4 |
| Molecular Weight | 358.74 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2,3,5,6-tetramethyl-1,4-diphenyl-1,4,2,3,5,6-diazatetrasilinane |
| SMILES | C[SiH]1N(c2ccccc2)[SiH](C)[SiH](C)N(c2ccccc2)[SiH]1C |
| InChI | InChI=1S/C16H26N2Si4/c1-19-17(15-11-7-5-8-12-15)21(3)22(4)18(20(19)2)16-13-9-6-10-14-16/h5-14,19-22H,1-4H3 |
| InChIKey | YUPGRYYDPJVCDA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.74 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|