About 5-methyl-1,4-diphenyltetrazaborole
5-methyl-1,4-diphenyltetrazaborole (PubChem CID 610458) has the molecular formula C13H13BN4
and a molecular weight of 236.09 g/mol. Its IUPAC name is 5-methyl-1,4-diphenyltetrazaborole.
Molecular Properties
| Compound Name | 5-methyl-1,4-diphenyltetrazaborole |
| PubChem CID | 610458 |
| Molecular Formula | C13H13BN4 |
| Molecular Weight | 236.09 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 5-methyl-1,4-diphenyltetrazaborole |
| SMILES | CB1N(c2ccccc2)N=NN1c1ccccc1 |
| InChI | InChI=1S/C13H13BN4/c1-14-17(12-8-4-2-5-9-12)15-16-18(14)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | XQVIZSMARUTOOA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.09 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1,4-diphenyltetrazaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,4-diphenyltetrazaborole?
The IUPAC name of 5-methyl-1,4-diphenyltetrazaborole (CID 610458) is 5-methyl-1,4-diphenyltetrazaborole.
What is the SMILES notation for 5-methyl-1,4-diphenyltetrazaborole?
The canonical SMILES for 5-methyl-1,4-diphenyltetrazaborole is CB1N(c2ccccc2)N=NN1c1ccccc1.
What is the InChIKey of 5-methyl-1,4-diphenyltetrazaborole?
The InChIKey is XQVIZSMARUTOOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BN4/c1-14-17(12-8-4-2-5-9-12)15-16-18(14)13-10-6-3-7-11-13/h2-11H,1H3.
What are the key properties of 5-methyl-1,4-diphenyltetrazaborole?
5-methyl-1,4-diphenyltetrazaborole has a molecular weight of 236.09 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,4-diphenyltetrazaborole is sourced from PubChem (CID 610458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).