C16H25N — CID 144805492
ethane;2,2,3,3-tetramethyl-1-phenylpyrrole (PubChem CID 144805492) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is ethane;2,2,3,3-tetramethyl-1-phenylpyrrole.
| Compound Name | ethane;2,2,3,3-tetramethyl-1-phenylpyrrole |
|---|---|
| PubChem CID | 144805492 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | ethane;2,2,3,3-tetramethyl-1-phenylpyrrole |
| SMILES | CC.CC1(C)C=CN(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C14H19N.C2H6/c1-13(2)10-11-15(14(13,3)4)12-8-6-5-7-9-12;1-2/h5-11H,1-4H3;1-2H3 |
| InChIKey | FKRDOLXZYQRRCY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |