C12H14N2O — CID 174525404
2-methyl-3-phenyl-1,6-dihydropyrimidine-2-carbaldehyde (PubChem CID 174525404) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-methyl-3-phenyl-1,6-dihydropyrimidine-2-carbaldehyde.
| Compound Name | 2-methyl-3-phenyl-1,6-dihydropyrimidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174525404 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-methyl-3-phenyl-1,6-dihydropyrimidine-2-carbaldehyde |
| SMILES | CC1(C=O)NCC=CN1c1ccccc1 |
| InChI | InChI=1S/C12H14N2O/c1-12(10-15)13-8-5-9-14(12)11-6-3-2-4-7-11/h2-7,9-10,13H,8H2,1H3 |
| InChIKey | MWIPRUFTOKHMTG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|