C10H12N2 — CID 174606195
4-methyl-2-phenyl-1,5-dihydropyrazole (PubChem CID 174606195) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 4-methyl-2-phenyl-1,5-dihydropyrazole.
| Compound Name | 4-methyl-2-phenyl-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 174606195 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4-methyl-2-phenyl-1,5-dihydropyrazole |
| SMILES | CC1=CN(c2ccccc2)NC1 |
| InChI | InChI=1S/C10H12N2/c1-9-7-11-12(8-9)10-5-3-2-4-6-10/h2-6,8,11H,7H2,1H3 |
| InChIKey | VVPBLAOXDVIWLP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |