About 4-methyl-1-phenyl-1,2,4-triazinane
4-methyl-1-phenyl-1,2,4-triazinane (PubChem CID 169115311) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-methyl-1-phenyl-1,2,4-triazinane.
Molecular Properties
| Compound Name | 4-methyl-1-phenyl-1,2,4-triazinane |
| PubChem CID | 169115311 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 4-methyl-1-phenyl-1,2,4-triazinane |
| SMILES | CN1CCN(c2ccccc2)NC1 |
| InChI | InChI=1S/C10H15N3/c1-12-7-8-13(11-9-12)10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3 |
| InChIKey | FIRXJAFAINSJNJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1-phenyl-1,2,4-triazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-phenyl-1,2,4-triazinane?
The IUPAC name of 4-methyl-1-phenyl-1,2,4-triazinane (CID 169115311) is 4-methyl-1-phenyl-1,2,4-triazinane.
What is the SMILES notation for 4-methyl-1-phenyl-1,2,4-triazinane?
The canonical SMILES for 4-methyl-1-phenyl-1,2,4-triazinane is CN1CCN(c2ccccc2)NC1.
What is the InChIKey of 4-methyl-1-phenyl-1,2,4-triazinane?
The InChIKey is FIRXJAFAINSJNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-12-7-8-13(11-9-12)10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3.
What are the key properties of 4-methyl-1-phenyl-1,2,4-triazinane?
4-methyl-1-phenyl-1,2,4-triazinane has a molecular weight of 177.25 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-phenyl-1,2,4-triazinane is sourced from PubChem (CID 169115311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).