C10H15N3 — CID 169115311
4-methyl-1-phenyl-1,2,4-triazinane (PubChem CID 169115311) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-methyl-1-phenyl-1,2,4-triazinane.
| Compound Name | 4-methyl-1-phenyl-1,2,4-triazinane |
|---|---|
| PubChem CID | 169115311 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 4-methyl-1-phenyl-1,2,4-triazinane |
| SMILES | CN1CCN(c2ccccc2)NC1 |
| InChI | InChI=1S/C10H15N3/c1-12-7-8-13(11-9-12)10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3 |
| InChIKey | FIRXJAFAINSJNJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |