About 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane
7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane (PubChem CID 70451139) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane.
Molecular Properties
| Compound Name | 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane |
| PubChem CID | 70451139 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane |
| SMILES | CN1CCN(c2ccccc2)C2(CC2)C1 |
| InChI | InChI=1S/C13H18N2/c1-14-9-10-15(13(11-14)7-8-13)12-5-3-2-4-6-12/h2-6H,7-11H2,1H3 |
| InChIKey | QAFHGDGMVZXOTO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane?
The IUPAC name of 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane (CID 70451139) is 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane.
What is the SMILES notation for 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane?
The canonical SMILES for 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane is CN1CCN(c2ccccc2)C2(CC2)C1.
What is the InChIKey of 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane?
The InChIKey is QAFHGDGMVZXOTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-14-9-10-15(13(11-14)7-8-13)12-5-3-2-4-6-12/h2-6H,7-11H2,1H3.
What are the key properties of 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane?
7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane has a molecular weight of 202.30 g/mol, XLogP of 1.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4-phenyl-4,7-diazaspiro[2.5]octane is sourced from PubChem (CID 70451139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).