C12H12N2O — CID 121001951
5-methyl-6-phenyl-1,2-diazabicyclo[3.2.0]hept-6-en-4-one (PubChem CID 121001951) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-methyl-6-phenyl-1,2-diazabicyclo[3.2.0]hept-6-en-4-one.
| Compound Name | 5-methyl-6-phenyl-1,2-diazabicyclo[3.2.0]hept-6-en-4-one |
|---|---|
| PubChem CID | 121001951 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 5-methyl-6-phenyl-1,2-diazabicyclo[3.2.0]hept-6-en-4-one |
| SMILES | CC12C(=O)CNN1C=C2c1ccccc1 |
| InChI | InChI=1S/C12H12N2O/c1-12-10(9-5-3-2-4-6-9)8-14(12)13-7-11(12)15/h2-6,8,13H,7H2,1H3 |
| InChIKey | QOGNYJICWWTUGS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |