C12H12N2O — CID 57151115
6-methyl-4-phenyl-1H-1,4-diazepin-7-one (PubChem CID 57151115) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 6-methyl-4-phenyl-1H-1,4-diazepin-7-one.
| Compound Name | 6-methyl-4-phenyl-1H-1,4-diazepin-7-one |
|---|---|
| PubChem CID | 57151115 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 6-methyl-4-phenyl-1H-1,4-diazepin-7-one |
| SMILES | CC1=CN(c2ccccc2)C=CNC1=O |
| InChI | InChI=1S/C12H12N2O/c1-10-9-14(8-7-13-12(10)15)11-5-3-2-4-6-11/h2-9H,1H3,(H,13,15) |
| InChIKey | YLSMOIIWKKPAHV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |