About 4-phenyl-1H-quinoxaline
4-phenyl-1H-quinoxaline (PubChem CID 174916009) has the molecular formula C14H12N2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-phenyl-1H-quinoxaline.
Molecular Properties
| Compound Name | 4-phenyl-1H-quinoxaline |
| PubChem CID | 174916009 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 4-phenyl-1H-quinoxaline |
| SMILES | C1=CN(c2ccccc2)c2ccccc2N1 |
| InChI | InChI=1S/C14H12N2/c1-2-6-12(7-3-1)16-11-10-15-13-8-4-5-9-14(13)16/h1-11,15H |
| InChIKey | IMDOWBVAJUZPMX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenyl-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1H-quinoxaline?
The IUPAC name of 4-phenyl-1H-quinoxaline (CID 174916009) is 4-phenyl-1H-quinoxaline.
What is the SMILES notation for 4-phenyl-1H-quinoxaline?
The canonical SMILES for 4-phenyl-1H-quinoxaline is C1=CN(c2ccccc2)c2ccccc2N1.
What is the InChIKey of 4-phenyl-1H-quinoxaline?
The InChIKey is IMDOWBVAJUZPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2/c1-2-6-12(7-3-1)16-11-10-15-13-8-4-5-9-14(13)16/h1-11,15H.
What are the key properties of 4-phenyl-1H-quinoxaline?
4-phenyl-1H-quinoxaline has a molecular weight of 208.26 g/mol, XLogP of 3.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1H-quinoxaline is sourced from PubChem (CID 174916009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).