C8H9NS2 — CID 101427405
4-phenyl-1,2,4-dithiazolidine (PubChem CID 101427405) has the molecular formula C8H9NS2 and a molecular weight of 183.30 g/mol. Its IUPAC name is 4-phenyl-1,2,4-dithiazolidine.
| Compound Name | 4-phenyl-1,2,4-dithiazolidine |
|---|---|
| PubChem CID | 101427405 |
| Molecular Formula | C8H9NS2 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 4-phenyl-1,2,4-dithiazolidine |
| SMILES | c1ccc(N2CSSC2)cc1 |
| InChI | InChI=1S/C8H9NS2/c1-2-4-8(5-3-1)9-6-10-11-7-9/h1-5H,6-7H2 |
| InChIKey | VQEZYFBJCVDUSO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|