C18H29NS3 — CID 44623274
13-phenyl-1,5,9-trithia-13-azacyclohexadecane (PubChem CID 44623274) has the molecular formula C18H29NS3 and a molecular weight of 355.64 g/mol. Its IUPAC name is 13-phenyl-1,5,9-trithia-13-azacyclohexadecane.
| Compound Name | 13-phenyl-1,5,9-trithia-13-azacyclohexadecane |
|---|---|
| PubChem CID | 44623274 |
| Molecular Formula | C18H29NS3 |
| Molecular Weight | 355.64 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 13-phenyl-1,5,9-trithia-13-azacyclohexadecane |
| SMILES | c1ccc(N2CCCSCCCSCCCSCCC2)cc1 |
| InChI | InChI=1S/C18H29NS3/c1-2-8-18(9-3-1)19-10-4-12-20-14-6-16-22-17-7-15-21-13-5-11-19/h1-3,8-9H,4-7,10-17H2 |
| InChIKey | WHASTMJHFVPRHU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |