C11H15N — CID 172759317
2,2,6,6-tetradeuterio-1-phenylpiperidine (PubChem CID 172759317) has the molecular formula C11H15N and a molecular weight of 165.27 g/mol. Its IUPAC name is 2,2,6,6-tetradeuterio-1-phenylpiperidine.
| Compound Name | 2,2,6,6-tetradeuterio-1-phenylpiperidine |
|---|---|
| PubChem CID | 172759317 |
| Molecular Formula | C11H15N |
| Molecular Weight | 165.27 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2,2,6,6-tetradeuterio-1-phenylpiperidine |
| SMILES | [2H]C1([2H])CCCC([2H])([2H])N1c1ccccc1 |
| InChI | InChI=1S/C11H15N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1,3-4,7-8H,2,5-6,9-10H2/i9D2,10D2 |
| InChIKey | LLSKXGRDUPMXLC-YQUBHJMPSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |