C10H12F2N2 — CID 176905401
3,5-difluoro-1-phenylpiperazine (PubChem CID 176905401) has the molecular formula C10H12F2N2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3,5-difluoro-1-phenylpiperazine.
| Compound Name | 3,5-difluoro-1-phenylpiperazine |
|---|---|
| PubChem CID | 176905401 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3,5-difluoro-1-phenylpiperazine |
| SMILES | FC1CN(c2ccccc2)CC(F)N1 |
| InChI | InChI=1S/C10H12F2N2/c11-9-6-14(7-10(12)13-9)8-4-2-1-3-5-8/h1-5,9-10,13H,6-7H2 |
| InChIKey | QCLUEWUWHGBQLF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|