C22H21NO — CID 102292623
(2R,6S)-2,4,6-triphenylmorpholine (PubChem CID 102292623) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is (2R,6S)-2,4,6-triphenylmorpholine.
| Compound Name | (2R,6S)-2,4,6-triphenylmorpholine |
|---|---|
| PubChem CID | 102292623 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (2R,6S)-2,4,6-triphenylmorpholine |
| SMILES | c1ccc([C@@H]2CN(c3ccccc3)C[C@H](c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C22H21NO/c1-4-10-18(11-5-1)21-16-23(20-14-8-3-9-15-20)17-22(24-21)19-12-6-2-7-13-19/h1-15,21-22H,16-17H2/t21-,22+ |
| InChIKey | VUCLDOAJYFCVRD-SZPZYZBQSA-N |
| XLogP | 5.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |