C17H20N2 — CID 64944093
1,3-diphenyl-1,4-diazepane (PubChem CID 64944093) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1,3-diphenyl-1,4-diazepane.
| Compound Name | 1,3-diphenyl-1,4-diazepane |
|---|---|
| PubChem CID | 64944093 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1,3-diphenyl-1,4-diazepane |
| SMILES | c1ccc(C2CN(c3ccccc3)CCCN2)cc1 |
| InChI | InChI=1S/C17H20N2/c1-3-8-15(9-4-1)17-14-19(13-7-12-18-17)16-10-5-2-6-11-16/h1-6,8-11,17-18H,7,12-14H2 |
| InChIKey | YFTVYPSERQOIQV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |