C17H18Br2N2 — CID 64943420
1-(2,5-dibromophenyl)-3-phenyl-1,4-diazepane (PubChem CID 64943420) has the molecular formula C17H18Br2N2 and a molecular weight of 410.15 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-3-phenyl-1,4-diazepane.
| Compound Name | 1-(2,5-dibromophenyl)-3-phenyl-1,4-diazepane |
|---|---|
| PubChem CID | 64943420 |
| Molecular Formula | C17H18Br2N2 |
| Molecular Weight | 410.15 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 1-(2,5-dibromophenyl)-3-phenyl-1,4-diazepane |
| SMILES | Brc1ccc(Br)c(N2CCCNC(c3ccccc3)C2)c1 |
| InChI | InChI=1S/C17H18Br2N2/c18-14-7-8-15(19)17(11-14)21-10-4-9-20-16(12-21)13-5-2-1-3-6-13/h1-3,5-8,11,16,20H,4,9-10,12H2 |
| InChIKey | NBGAYALLZURXFU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.15 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |